C16H23N3 — CID 102074049
(1S,2S)-N,N-diethyl-1-imidazol-1-yl-1-phenylpropan-2-amine (PubChem CID 102074049) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is (1S,2S)-N,N-diethyl-1-imidazol-1-yl-1-phenylpropan-2-amine.
| Compound Name | (1S,2S)-N,N-diethyl-1-imidazol-1-yl-1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 102074049 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | (1S,2S)-N,N-diethyl-1-imidazol-1-yl-1-phenylpropan-2-amine |
| SMILES | CCN(CC)[C@@H](C)[C@H](c1ccccc1)n1ccnc1 |
| InChI | InChI=1S/C16H23N3/c1-4-18(5-2)14(3)16(19-12-11-17-13-19)15-9-7-6-8-10-15/h6-14,16H,4-5H2,1-3H3/t14-,16+/m0/s1 |
| InChIKey | QLNFOPMZOHWHJW-GOEBONIOSA-N |
| XLogP | 3.20 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |