About (1S,2S)-N,N-diethyl-1-imidazol-1-yl-1-phenylpropan-2-amine
(1S,2S)-N,N-diethyl-1-imidazol-1-yl-1-phenylpropan-2-amine (PubChem CID 102074049) has the molecular formula C16H23N3
and a molecular weight of 257.38 g/mol. Its IUPAC name is (1S,2S)-N,N-diethyl-1-imidazol-1-yl-1-phenylpropan-2-amine.
Molecular Properties
| Compound Name | (1S,2S)-N,N-diethyl-1-imidazol-1-yl-1-phenylpropan-2-amine |
| PubChem CID | 102074049 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | (1S,2S)-N,N-diethyl-1-imidazol-1-yl-1-phenylpropan-2-amine |
| SMILES | CCN(CC)[C@@H](C)[C@H](c1ccccc1)n1ccnc1 |
| InChI | InChI=1S/C16H23N3/c1-4-18(5-2)14(3)16(19-12-11-17-13-19)15-9-7-6-8-10-15/h6-14,16H,4-5H2,1-3H3/t14-,16+/m0/s1 |
| InChIKey | QLNFOPMZOHWHJW-GOEBONIOSA-N |
| XLogP | 3.20 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S,2S)-N,N-diethyl-1-imidazol-1-yl-1-phenylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-N,N-diethyl-1-imidazol-1-yl-1-phenylpropan-2-amine?
The IUPAC name of (1S,2S)-N,N-diethyl-1-imidazol-1-yl-1-phenylpropan-2-amine (CID 102074049) is (1S,2S)-N,N-diethyl-1-imidazol-1-yl-1-phenylpropan-2-amine.
What is the SMILES notation for (1S,2S)-N,N-diethyl-1-imidazol-1-yl-1-phenylpropan-2-amine?
The canonical SMILES for (1S,2S)-N,N-diethyl-1-imidazol-1-yl-1-phenylpropan-2-amine is CCN(CC)[C@@H](C)[C@H](c1ccccc1)n1ccnc1.
What is the InChIKey of (1S,2S)-N,N-diethyl-1-imidazol-1-yl-1-phenylpropan-2-amine?
The InChIKey is QLNFOPMZOHWHJW-GOEBONIOSA-N. The full InChI is InChI=1S/C16H23N3/c1-4-18(5-2)14(3)16(19-12-11-17-13-19)15-9-7-6-8-10-15/h6-14,16H,4-5H2,1-3H3/t14-,16+/m0/s1.
What are the key properties of (1S,2S)-N,N-diethyl-1-imidazol-1-yl-1-phenylpropan-2-amine?
(1S,2S)-N,N-diethyl-1-imidazol-1-yl-1-phenylpropan-2-amine has a molecular weight of 257.38 g/mol, XLogP of 3.20, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-N,N-diethyl-1-imidazol-1-yl-1-phenylpropan-2-amine is sourced from PubChem (CID 102074049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).