C14H19N3O4S2 — CID 167825209
N-[(3,5-dimethylphenyl)methylsulfonyl]-2-ethylpyrazole-3-sulfonamide (PubChem CID 167825209) has the molecular formula C14H19N3O4S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is N-[(3,5-dimethylphenyl)methylsulfonyl]-2-ethylpyrazole-3-sulfonamide.
| Compound Name | N-[(3,5-dimethylphenyl)methylsulfonyl]-2-ethylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 167825209 |
| Molecular Formula | C14H19N3O4S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-[(3,5-dimethylphenyl)methylsulfonyl]-2-ethylpyrazole-3-sulfonamide |
| SMILES | CCn1nccc1S(=O)(=O)NS(=O)(=O)Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C14H19N3O4S2/c1-4-17-14(5-6-15-17)23(20,21)16-22(18,19)10-13-8-11(2)7-12(3)9-13/h5-9,16H,4,10H2,1-3H3 |
| InChIKey | RDFGSIUPFZBEFM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |