C19H18ClF3N4O — CID 167826554
2-[[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-3-yl]amino]-6-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 167826554) has the molecular formula C19H18ClF3N4O and a molecular weight of 410.83 g/mol. Its IUPAC name is 2-[[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-3-yl]amino]-6-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-[[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-3-yl]amino]-6-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 167826554 |
| Molecular Formula | C19H18ClF3N4O |
| Molecular Weight | 410.83 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 2-[[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-3-yl]amino]-6-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(C(F)(F)F)nc1NC1CCCN(Cc2cc(Cl)ccc2O)C1 |
| InChI | InChI=1S/C19H18ClF3N4O/c20-14-4-5-16(28)13(8-14)10-27-7-1-2-15(11-27)25-18-12(9-24)3-6-17(26-18)19(21,22)23/h3-6,8,15,28H,1-2,7,10-11H2,(H,25,26) |
| InChIKey | HZFRVAZDPITVJI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.83 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|