C18H19ClN4O5 — CID 97010889
4-chloro-2-[[(3S)-3-(2,4-dinitroanilino)piperidin-1-yl]methyl]phenol (PubChem CID 97010889) has the molecular formula C18H19ClN4O5 and a molecular weight of 406.83 g/mol. Its IUPAC name is 4-chloro-2-[[(3S)-3-(2,4-dinitroanilino)piperidin-1-yl]methyl]phenol.
| Compound Name | 4-chloro-2-[[(3S)-3-(2,4-dinitroanilino)piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 97010889 |
| Molecular Formula | C18H19ClN4O5 |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 4-chloro-2-[[(3S)-3-(2,4-dinitroanilino)piperidin-1-yl]methyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(N[C@H]2CCCN(Cc3cc(Cl)ccc3O)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19ClN4O5/c19-13-3-6-18(24)12(8-13)10-21-7-1-2-14(11-21)20-16-5-4-15(22(25)26)9-17(16)23(27)28/h3-6,8-9,14,20,24H,1-2,7,10-11H2/t14-/m0/s1 |
| InChIKey | PYQPPBKMSXWEBW-AWEZNQCLSA-N |
| XLogP | 3.94 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|