C17H19N5O2 — CID 167827892
3-[2-[[(2S,3S)-2-(1H-pyrazol-5-yl)oxolan-3-yl]amino]ethyl]quinazolin-4-one (PubChem CID 167827892) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 3-[2-[[(2S,3S)-2-(1H-pyrazol-5-yl)oxolan-3-yl]amino]ethyl]quinazolin-4-one.
| Compound Name | 3-[2-[[(2S,3S)-2-(1H-pyrazol-5-yl)oxolan-3-yl]amino]ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 167827892 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 3-[2-[[(2S,3S)-2-(1H-pyrazol-5-yl)oxolan-3-yl]amino]ethyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2ncn1CCN[C@H]1CCO[C@@H]1c1ccn[nH]1 |
| InChI | InChI=1S/C17H19N5O2/c23-17-12-3-1-2-4-13(12)19-11-22(17)9-8-18-14-6-10-24-16(14)15-5-7-20-21-15/h1-5,7,11,14,16,18H,6,8-10H2,(H,20,21)/t14-,16-/m0/s1 |
| InChIKey | PJKXJFUNXUABKZ-HOCLYGCPSA-N |
| XLogP | 1.24 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |