C20H24N4O — CID 167830379
N-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxan-3-yl]methyl]isoquinolin-6-amine (PubChem CID 167830379) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxan-3-yl]methyl]isoquinolin-6-amine.
| Compound Name | N-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxan-3-yl]methyl]isoquinolin-6-amine |
|---|---|
| PubChem CID | 167830379 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxan-3-yl]methyl]isoquinolin-6-amine |
| SMILES | CCn1nccc1[C@@H]1OCCC[C@H]1CNc1ccc2cnccc2c1 |
| InChI | InChI=1S/C20H24N4O/c1-2-24-19(8-10-23-24)20-17(4-3-11-25-20)14-22-18-6-5-16-13-21-9-7-15(16)12-18/h5-10,12-13,17,20,22H,2-4,11,14H2,1H3/t17-,20+/m0/s1 |
| InChIKey | HXIJZHJNEOFWDH-FXAWDEMLSA-N |
| XLogP | 4.03 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |