C20H17ClN2O — CID 167832627
1-[3-(3-chlorophenyl)azetidin-1-yl]-2-quinolin-6-ylethanone (PubChem CID 167832627) has the molecular formula C20H17ClN2O and a molecular weight of 336.82 g/mol. Its IUPAC name is 1-[3-(3-chlorophenyl)azetidin-1-yl]-2-quinolin-6-ylethanone.
| Compound Name | 1-[3-(3-chlorophenyl)azetidin-1-yl]-2-quinolin-6-ylethanone |
|---|---|
| PubChem CID | 167832627 |
| Molecular Formula | C20H17ClN2O |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-[3-(3-chlorophenyl)azetidin-1-yl]-2-quinolin-6-ylethanone |
| SMILES | O=C(Cc1ccc2ncccc2c1)N1CC(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C20H17ClN2O/c21-18-5-1-3-15(11-18)17-12-23(13-17)20(24)10-14-6-7-19-16(9-14)4-2-8-22-19/h1-9,11,17H,10,12-13H2 |
| InChIKey | XLRNUOFJNIBPHU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |