C22H21ClN2O — CID 42198031
(4-chlorophenyl)-[(3S)-1-(quinolin-6-ylmethyl)piperidin-3-yl]methanone (PubChem CID 42198031) has the molecular formula C22H21ClN2O and a molecular weight of 364.88 g/mol. Its IUPAC name is (4-chlorophenyl)-[(3S)-1-(quinolin-6-ylmethyl)piperidin-3-yl]methanone.
| Compound Name | (4-chlorophenyl)-[(3S)-1-(quinolin-6-ylmethyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 42198031 |
| Molecular Formula | C22H21ClN2O |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (4-chlorophenyl)-[(3S)-1-(quinolin-6-ylmethyl)piperidin-3-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)[C@H]1CCCN(Cc2ccc3ncccc3c2)C1 |
| InChI | InChI=1S/C22H21ClN2O/c23-20-8-6-17(7-9-20)22(26)19-4-2-12-25(15-19)14-16-5-10-21-18(13-16)3-1-11-24-21/h1,3,5-11,13,19H,2,4,12,14-15H2/t19-/m0/s1 |
| InChIKey | BAASLYUZRXOHEG-IBGZPJMESA-N |
| XLogP | 4.98 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |