C22H22ClN3O — CID 42520305
(4-chlorophenyl)-[(3R)-1-[(1-pyridin-2-ylpyrrol-2-yl)methyl]piperidin-3-yl]methanone (PubChem CID 42520305) has the molecular formula C22H22ClN3O and a molecular weight of 379.89 g/mol. Its IUPAC name is (4-chlorophenyl)-[(3R)-1-[(1-pyridin-2-ylpyrrol-2-yl)methyl]piperidin-3-yl]methanone.
| Compound Name | (4-chlorophenyl)-[(3R)-1-[(1-pyridin-2-ylpyrrol-2-yl)methyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 42520305 |
| Molecular Formula | C22H22ClN3O |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (4-chlorophenyl)-[(3R)-1-[(1-pyridin-2-ylpyrrol-2-yl)methyl]piperidin-3-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)[C@@H]1CCCN(Cc2cccn2-c2ccccn2)C1 |
| InChI | InChI=1S/C22H22ClN3O/c23-19-10-8-17(9-11-19)22(27)18-5-3-13-25(15-18)16-20-6-4-14-26(20)21-7-1-2-12-24-21/h1-2,4,6-12,14,18H,3,5,13,15-16H2/t18-/m1/s1 |
| InChIKey | YZSCVGMHSCGXIL-GOSISDBHSA-N |
| XLogP | 4.62 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |