C16H19ClN4O — CID 3968198
1-[[1-(2-chloro-3-pyridinyl)pyrrol-2-yl]methyl]piperidine-3-carboxamide (PubChem CID 3968198) has the molecular formula C16H19ClN4O and a molecular weight of 318.81 g/mol. Its IUPAC name is 1-[[1-(2-chloro-3-pyridinyl)pyrrol-2-yl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-[[1-(2-chloro-3-pyridinyl)pyrrol-2-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 3968198 |
| Molecular Formula | C16H19ClN4O |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-[[1-(2-chloro-3-pyridinyl)pyrrol-2-yl]methyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(Cc2cccn2-c2cccnc2Cl)C1 |
| InChI | InChI=1S/C16H19ClN4O/c17-15-14(6-1-7-19-15)21-9-3-5-13(21)11-20-8-2-4-12(10-20)16(18)22/h1,3,5-7,9,12H,2,4,8,10-11H2,(H2,18,22) |
| InChIKey | ZVPWUWQZKFJUDJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|