C23H22ClN3O2 — CID 25460911
(4-chlorophenyl)-[(3R)-1-[(4-pyrimidin-2-yloxyphenyl)methyl]piperidin-3-yl]methanone (PubChem CID 25460911) has the molecular formula C23H22ClN3O2 and a molecular weight of 407.90 g/mol. Its IUPAC name is (4-chlorophenyl)-[(3R)-1-[(4-pyrimidin-2-yloxyphenyl)methyl]piperidin-3-yl]methanone.
| Compound Name | (4-chlorophenyl)-[(3R)-1-[(4-pyrimidin-2-yloxyphenyl)methyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 25460911 |
| Molecular Formula | C23H22ClN3O2 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (4-chlorophenyl)-[(3R)-1-[(4-pyrimidin-2-yloxyphenyl)methyl]piperidin-3-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)[C@@H]1CCCN(Cc2ccc(Oc3ncccn3)cc2)C1 |
| InChI | InChI=1S/C23H22ClN3O2/c24-20-8-6-18(7-9-20)22(28)19-3-1-14-27(16-19)15-17-4-10-21(11-5-17)29-23-25-12-2-13-26-23/h2,4-13,19H,1,3,14-16H2/t19-/m1/s1 |
| InChIKey | QKMXJQPMGZOVBW-LJQANCHMSA-N |
| XLogP | 5.02 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |