C25H31N5 — CID 29025981
1-phenyl-4-[(3S)-1-[(1-pyridin-2-ylpyrrol-2-yl)methyl]piperidin-3-yl]piperazine (PubChem CID 29025981) has the molecular formula C25H31N5 and a molecular weight of 401.56 g/mol. Its IUPAC name is 1-phenyl-4-[(3S)-1-[(1-pyridin-2-ylpyrrol-2-yl)methyl]piperidin-3-yl]piperazine.
| Compound Name | 1-phenyl-4-[(3S)-1-[(1-pyridin-2-ylpyrrol-2-yl)methyl]piperidin-3-yl]piperazine |
|---|---|
| PubChem CID | 29025981 |
| Molecular Formula | C25H31N5 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | 1-phenyl-4-[(3S)-1-[(1-pyridin-2-ylpyrrol-2-yl)methyl]piperidin-3-yl]piperazine |
| SMILES | c1ccc(N2CCN([C@H]3CCCN(Cc4cccn4-c4ccccn4)C3)CC2)cc1 |
| InChI | InChI=1S/C25H31N5/c1-2-8-22(9-3-1)28-16-18-29(19-17-28)23-10-6-14-27(20-23)21-24-11-7-15-30(24)25-12-4-5-13-26-25/h1-5,7-9,11-13,15,23H,6,10,14,16-21H2/t23-/m0/s1 |
| InChIKey | DZDQNOPGIHQEMH-QHCPKHFHSA-N |
| XLogP | 3.66 |
| TPSA | 27.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |