C24H30N6 — CID 45201583
2-[2-[[3-(4-phenylpiperazin-1-yl)piperidin-1-yl]methyl]pyrrol-1-yl]pyrimidine (PubChem CID 45201583) has the molecular formula C24H30N6 and a molecular weight of 402.55 g/mol. Its IUPAC name is 2-[2-[[3-(4-phenylpiperazin-1-yl)piperidin-1-yl]methyl]pyrrol-1-yl]pyrimidine.
| Compound Name | 2-[2-[[3-(4-phenylpiperazin-1-yl)piperidin-1-yl]methyl]pyrrol-1-yl]pyrimidine |
|---|---|
| PubChem CID | 45201583 |
| Molecular Formula | C24H30N6 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 2-[2-[[3-(4-phenylpiperazin-1-yl)piperidin-1-yl]methyl]pyrrol-1-yl]pyrimidine |
| SMILES | c1ccc(N2CCN(C3CCCN(Cc4cccn4-c4ncccn4)C3)CC2)cc1 |
| InChI | InChI=1S/C24H30N6/c1-2-7-21(8-3-1)28-15-17-29(18-16-28)22-9-4-13-27(19-22)20-23-10-5-14-30(23)24-25-11-6-12-26-24/h1-3,5-8,10-12,14,22H,4,9,13,15-20H2 |
| InChIKey | JZJOOTSJQWXPTR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 40.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |