C25H30FN5 — CID 45195712
1-(4-fluorophenyl)-4-[1-[(1-pyridin-2-ylpyrrol-2-yl)methyl]piperidin-3-yl]piperazine (PubChem CID 45195712) has the molecular formula C25H30FN5 and a molecular weight of 419.55 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[1-[(1-pyridin-2-ylpyrrol-2-yl)methyl]piperidin-3-yl]piperazine.
| Compound Name | 1-(4-fluorophenyl)-4-[1-[(1-pyridin-2-ylpyrrol-2-yl)methyl]piperidin-3-yl]piperazine |
|---|---|
| PubChem CID | 45195712 |
| Molecular Formula | C25H30FN5 |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[1-[(1-pyridin-2-ylpyrrol-2-yl)methyl]piperidin-3-yl]piperazine |
| SMILES | Fc1ccc(N2CCN(C3CCCN(Cc4cccn4-c4ccccn4)C3)CC2)cc1 |
| InChI | InChI=1S/C25H30FN5/c26-21-8-10-22(11-9-21)29-15-17-30(18-16-29)23-5-3-13-28(19-23)20-24-6-4-14-31(24)25-7-1-2-12-27-25/h1-2,4,6-12,14,23H,3,5,13,15-20H2 |
| InChIKey | JPDFREOYTHRQSN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 27.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |