C23H23F3N4O — CID 155234309
1-[4-[2-amino-6-(trifluoromethyl)anilino]piperidin-1-yl]-2-quinolin-6-ylethanone (PubChem CID 155234309) has the molecular formula C23H23F3N4O and a molecular weight of 428.46 g/mol. Its IUPAC name is 1-[4-[2-amino-6-(trifluoromethyl)anilino]piperidin-1-yl]-2-quinolin-6-ylethanone.
| Compound Name | 1-[4-[2-amino-6-(trifluoromethyl)anilino]piperidin-1-yl]-2-quinolin-6-ylethanone |
|---|---|
| PubChem CID | 155234309 |
| Molecular Formula | C23H23F3N4O |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 1-[4-[2-amino-6-(trifluoromethyl)anilino]piperidin-1-yl]-2-quinolin-6-ylethanone |
| SMILES | Nc1cccc(C(F)(F)F)c1NC1CCN(C(=O)Cc2ccc3ncccc3c2)CC1 |
| InChI | InChI=1S/C23H23F3N4O/c24-23(25,26)18-4-1-5-19(27)22(18)29-17-8-11-30(12-9-17)21(31)14-15-6-7-20-16(13-15)3-2-10-28-20/h1-7,10,13,17,29H,8-9,11-12,14,27H2 |
| InChIKey | QIDIXOZFSSJJAU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|