C28H28N4O4 — CID 167832722
4-[(3,5-dimethylpyrazol-1-yl)methyl]-N'-[2-(4-phenylmethoxyphenoxy)acetyl]benzohydrazide (PubChem CID 167832722) has the molecular formula C28H28N4O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N'-[2-(4-phenylmethoxyphenoxy)acetyl]benzohydrazide.
| Compound Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N'-[2-(4-phenylmethoxyphenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 167832722 |
| Molecular Formula | C28H28N4O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N'-[2-(4-phenylmethoxyphenoxy)acetyl]benzohydrazide |
| SMILES | Cc1cc(C)n(Cc2ccc(C(=O)NNC(=O)COc3ccc(OCc4ccccc4)cc3)cc2)n1 |
| InChI | InChI=1S/C28H28N4O4/c1-20-16-21(2)32(31-20)17-22-8-10-24(11-9-22)28(34)30-29-27(33)19-36-26-14-12-25(13-15-26)35-18-23-6-4-3-5-7-23/h3-16H,17-19H2,1-2H3,(H,29,33)(H,30,34) |
| InChIKey | IOJHNLYUEQNNIS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|