C23H25N5O3S — CID 138391760
N-[[[2-(3,5-dimethylpyrazol-1-yl)acetyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide (PubChem CID 138391760) has the molecular formula C23H25N5O3S and a molecular weight of 451.55 g/mol. Its IUPAC name is N-[[[2-(3,5-dimethylpyrazol-1-yl)acetyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide.
| Compound Name | N-[[[2-(3,5-dimethylpyrazol-1-yl)acetyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 138391760 |
| Molecular Formula | C23H25N5O3S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | N-[[[2-(3,5-dimethylpyrazol-1-yl)acetyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide |
| SMILES | Cc1cc(C)n(CC(=O)NNC(=S)NC(=O)c2ccc(OCCc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C23H25N5O3S/c1-16-14-17(2)28(27-16)15-21(29)25-26-23(32)24-22(30)19-8-10-20(11-9-19)31-13-12-18-6-4-3-5-7-18/h3-11,14H,12-13,15H2,1-2H3,(H,25,29)(H2,24,26,30,32) |
| InChIKey | ANTRJRLGWLFDFM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|