C24H29N3O3S — CID 138391727
N-[[(2-cyclohexylacetyl)amino]carbamothioyl]-4-(2-phenylethoxy)benzamide (PubChem CID 138391727) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-[[(2-cyclohexylacetyl)amino]carbamothioyl]-4-(2-phenylethoxy)benzamide.
| Compound Name | N-[[(2-cyclohexylacetyl)amino]carbamothioyl]-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 138391727 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[[(2-cyclohexylacetyl)amino]carbamothioyl]-4-(2-phenylethoxy)benzamide |
| SMILES | O=C(CC1CCCCC1)NNC(=S)NC(=O)c1ccc(OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H29N3O3S/c28-22(17-19-9-5-2-6-10-19)26-27-24(31)25-23(29)20-11-13-21(14-12-20)30-16-15-18-7-3-1-4-8-18/h1,3-4,7-8,11-14,19H,2,5-6,9-10,15-17H2,(H,26,28)(H2,25,27,29,31) |
| InChIKey | WIKOHOMSOXMXJR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|