C15H17F3N2O3S2 — CID 167833230
3-(1,3-benzothiazol-2-yl)-4-(4,4,4-trifluorobutylsulfonyl)morpholine (PubChem CID 167833230) has the molecular formula C15H17F3N2O3S2 and a molecular weight of 394.44 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-4-(4,4,4-trifluorobutylsulfonyl)morpholine.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-4-(4,4,4-trifluorobutylsulfonyl)morpholine |
|---|---|
| PubChem CID | 167833230 |
| Molecular Formula | C15H17F3N2O3S2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-4-(4,4,4-trifluorobutylsulfonyl)morpholine |
| SMILES | O=S(=O)(CCCC(F)(F)F)N1CCOCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H17F3N2O3S2/c16-15(17,18)6-3-9-25(21,22)20-7-8-23-10-12(20)14-19-11-4-1-2-5-13(11)24-14/h1-2,4-5,12H,3,6-10H2 |
| InChIKey | KOVYHAKCZCIXPY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |