C19H20N2O2S — CID 167833450
1-[(4-cyanothiophen-2-yl)methyl]-4-(3-methylphenyl)piperidine-4-carboxylic acid (PubChem CID 167833450) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is 1-[(4-cyanothiophen-2-yl)methyl]-4-(3-methylphenyl)piperidine-4-carboxylic acid.
| Compound Name | 1-[(4-cyanothiophen-2-yl)methyl]-4-(3-methylphenyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 167833450 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-[(4-cyanothiophen-2-yl)methyl]-4-(3-methylphenyl)piperidine-4-carboxylic acid |
| SMILES | Cc1cccc(C2(C(=O)O)CCN(Cc3cc(C#N)cs3)CC2)c1 |
| InChI | InChI=1S/C19H20N2O2S/c1-14-3-2-4-16(9-14)19(18(22)23)5-7-21(8-6-19)12-17-10-15(11-20)13-24-17/h2-4,9-10,13H,5-8,12H2,1H3,(H,22,23) |
| InChIKey | MBVOFQQTEOYQIR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |