C18H28FN3O3 — CID 167834385
tert-butyl 3-(5-fluoropentyl)-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate (PubChem CID 167834385) has the molecular formula C18H28FN3O3 and a molecular weight of 353.44 g/mol. Its IUPAC name is tert-butyl 3-(5-fluoropentyl)-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate.
| Compound Name | tert-butyl 3-(5-fluoropentyl)-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate |
|---|---|
| PubChem CID | 167834385 |
| Molecular Formula | C18H28FN3O3 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | tert-butyl 3-(5-fluoropentyl)-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2ncn(CCCCCF)c(=O)c2CC1 |
| InChI | InChI=1S/C18H28FN3O3/c1-18(2,3)25-17(24)21-11-7-14-15(8-12-21)20-13-22(16(14)23)10-6-4-5-9-19/h13H,4-12H2,1-3H3 |
| InChIKey | CRCVLDGINCANQE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|