C18H29N3O3 — CID 167953384
tert-butyl 4-oxo-3-pentyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate (PubChem CID 167953384) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is tert-butyl 4-oxo-3-pentyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate.
| Compound Name | tert-butyl 4-oxo-3-pentyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate |
|---|---|
| PubChem CID | 167953384 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | tert-butyl 4-oxo-3-pentyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate |
| SMILES | CCCCCn1cnc2c(c1=O)CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C18H29N3O3/c1-5-6-7-10-21-13-19-15-9-12-20(11-8-14(15)16(21)22)17(23)24-18(2,3)4/h13H,5-12H2,1-4H3 |
| InChIKey | FKOQTMHGKIGOST-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|