C15H18N4O2S — CID 167837268
N-(2-oxo-1,3-diazinan-1-yl)-3-pyrrol-1-yl-3-thiophen-2-ylpropanamide (PubChem CID 167837268) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-(2-oxo-1,3-diazinan-1-yl)-3-pyrrol-1-yl-3-thiophen-2-ylpropanamide.
| Compound Name | N-(2-oxo-1,3-diazinan-1-yl)-3-pyrrol-1-yl-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 167837268 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-(2-oxo-1,3-diazinan-1-yl)-3-pyrrol-1-yl-3-thiophen-2-ylpropanamide |
| SMILES | O=C(CC(c1cccs1)n1cccc1)NN1CCCNC1=O |
| InChI | InChI=1S/C15H18N4O2S/c20-14(17-19-9-4-6-16-15(19)21)11-12(13-5-3-10-22-13)18-7-1-2-8-18/h1-3,5,7-8,10,12H,4,6,9,11H2,(H,16,21)(H,17,20) |
| InChIKey | DQTCACNNIFZPND-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |