C13H13BrN2O3 — CID 167837728
3-amino-4-[2-(4-bromophenoxy)propylamino]cyclobut-3-ene-1,2-dione (PubChem CID 167837728) has the molecular formula C13H13BrN2O3 and a molecular weight of 325.16 g/mol. Its IUPAC name is 3-amino-4-[2-(4-bromophenoxy)propylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-[2-(4-bromophenoxy)propylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 167837728 |
| Molecular Formula | C13H13BrN2O3 |
| Molecular Weight | 325.16 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 3-amino-4-[2-(4-bromophenoxy)propylamino]cyclobut-3-ene-1,2-dione |
| SMILES | CC(CNc1c(N)c(=O)c1=O)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H13BrN2O3/c1-7(19-9-4-2-8(14)3-5-9)6-16-11-10(15)12(17)13(11)18/h2-5,7,16H,6,15H2,1H3 |
| InChIKey | HWOJPZQXECTKOV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.16 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|