C12H11BrN2O3 — CID 167893265
3-amino-4-[[(2S)-2-(4-bromophenyl)-2-hydroxyethyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 167893265) has the molecular formula C12H11BrN2O3 and a molecular weight of 311.13 g/mol. Its IUPAC name is 3-amino-4-[[(2S)-2-(4-bromophenyl)-2-hydroxyethyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-[[(2S)-2-(4-bromophenyl)-2-hydroxyethyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 167893265 |
| Molecular Formula | C12H11BrN2O3 |
| Molecular Weight | 311.13 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 3-amino-4-[[(2S)-2-(4-bromophenyl)-2-hydroxyethyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | Nc1c(NC[C@@H](O)c2ccc(Br)cc2)c(=O)c1=O |
| InChI | InChI=1S/C12H11BrN2O3/c13-7-3-1-6(2-4-7)8(16)5-15-10-9(14)11(17)12(10)18/h1-4,8,15-16H,5,14H2/t8-/m1/s1 |
| InChIKey | AGDXEUZYDIYSKO-MRVPVSSYSA-N |
| XLogP | 0.77 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.13 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|