C14H11BrF3NO — CID 60900638
2-(2-bromo-4,6-difluoroanilino)-1-(4-fluorophenyl)ethanol (PubChem CID 60900638) has the molecular formula C14H11BrF3NO and a molecular weight of 346.15 g/mol. Its IUPAC name is 2-(2-bromo-4,6-difluoroanilino)-1-(4-fluorophenyl)ethanol.
| Compound Name | 2-(2-bromo-4,6-difluoroanilino)-1-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 60900638 |
| Molecular Formula | C14H11BrF3NO |
| Molecular Weight | 346.15 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 2-(2-bromo-4,6-difluoroanilino)-1-(4-fluorophenyl)ethanol |
| SMILES | OC(CNc1c(F)cc(F)cc1Br)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H11BrF3NO/c15-11-5-10(17)6-12(18)14(11)19-7-13(20)8-1-3-9(16)4-2-8/h1-6,13,19-20H,7H2 |
| InChIKey | NVHPYCRNRPPTPP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.15 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |