C10H9BrF4N2O — CID 86816004
2-(2-bromo-4,6-difluoroanilino)-N-(2,2-difluoroethyl)acetamide (PubChem CID 86816004) has the molecular formula C10H9BrF4N2O and a molecular weight of 329.09 g/mol. Its IUPAC name is 2-(2-bromo-4,6-difluoroanilino)-N-(2,2-difluoroethyl)acetamide.
| Compound Name | 2-(2-bromo-4,6-difluoroanilino)-N-(2,2-difluoroethyl)acetamide |
|---|---|
| PubChem CID | 86816004 |
| Molecular Formula | C10H9BrF4N2O |
| Molecular Weight | 329.09 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 2-(2-bromo-4,6-difluoroanilino)-N-(2,2-difluoroethyl)acetamide |
| SMILES | O=C(CNc1c(F)cc(F)cc1Br)NCC(F)F |
| InChI | InChI=1S/C10H9BrF4N2O/c11-6-1-5(12)2-7(13)10(6)17-4-9(18)16-3-8(14)15/h1-2,8,17H,3-4H2,(H,16,18) |
| InChIKey | NJXNOMVPEXEBFI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.09 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |