C16H17FN4O2 — CID 167837787
(E)-3-(4-fluorophenyl)-1-[3-hydroxy-3-(2H-triazol-4-yl)pyrrolidin-1-yl]but-2-en-1-one (PubChem CID 167837787) has the molecular formula C16H17FN4O2 and a molecular weight of 316.34 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-1-[3-hydroxy-3-(2H-triazol-4-yl)pyrrolidin-1-yl]but-2-en-1-one.
| Compound Name | (E)-3-(4-fluorophenyl)-1-[3-hydroxy-3-(2H-triazol-4-yl)pyrrolidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 167837787 |
| Molecular Formula | C16H17FN4O2 |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-1-[3-hydroxy-3-(2H-triazol-4-yl)pyrrolidin-1-yl]but-2-en-1-one |
| SMILES | C/C(=C\C(=O)N1CCC(O)(c2cn[nH]n2)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H17FN4O2/c1-11(12-2-4-13(17)5-3-12)8-15(22)21-7-6-16(23,10-21)14-9-18-20-19-14/h2-5,8-9,23H,6-7,10H2,1H3,(H,18,19,20)/b11-8+ |
| InChIKey | PSPAEAOXNOOLAG-DHZHZOJOSA-N |
| XLogP | 1.47 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|