C13H16N4O4S — CID 167840333
4-[(2-ethyltriazol-4-yl)methylsulfamoylmethyl]benzoic acid (PubChem CID 167840333) has the molecular formula C13H16N4O4S and a molecular weight of 324.36 g/mol. Its IUPAC name is 4-[(2-ethyltriazol-4-yl)methylsulfamoylmethyl]benzoic acid.
| Compound Name | 4-[(2-ethyltriazol-4-yl)methylsulfamoylmethyl]benzoic acid |
|---|---|
| PubChem CID | 167840333 |
| Molecular Formula | C13H16N4O4S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 4-[(2-ethyltriazol-4-yl)methylsulfamoylmethyl]benzoic acid |
| SMILES | CCn1ncc(CNS(=O)(=O)Cc2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C13H16N4O4S/c1-2-17-14-7-12(16-17)8-15-22(20,21)9-10-3-5-11(6-4-10)13(18)19/h3-7,15H,2,8-9H2,1H3,(H,18,19) |
| InChIKey | ISUUYWAGIVGDLS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |