C14H17F3O3 — CID 167841226
2-[2-[5-methyl-2-(trifluoromethyl)phenoxy]ethyl]-1,4-dioxane (PubChem CID 167841226) has the molecular formula C14H17F3O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-[2-[5-methyl-2-(trifluoromethyl)phenoxy]ethyl]-1,4-dioxane.
| Compound Name | 2-[2-[5-methyl-2-(trifluoromethyl)phenoxy]ethyl]-1,4-dioxane |
|---|---|
| PubChem CID | 167841226 |
| Molecular Formula | C14H17F3O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-[2-[5-methyl-2-(trifluoromethyl)phenoxy]ethyl]-1,4-dioxane |
| SMILES | Cc1ccc(C(F)(F)F)c(OCCC2COCCO2)c1 |
| InChI | InChI=1S/C14H17F3O3/c1-10-2-3-12(14(15,16)17)13(8-10)20-5-4-11-9-18-6-7-19-11/h2-3,8,11H,4-7,9H2,1H3 |
| InChIKey | NCFVPHPHEAHXGM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |