C13H15F3O5S — CID 166266733
2-[2-[4-(trifluoromethylsulfonyl)phenoxy]ethyl]-1,4-dioxane (PubChem CID 166266733) has the molecular formula C13H15F3O5S and a molecular weight of 340.32 g/mol. Its IUPAC name is 2-[2-[4-(trifluoromethylsulfonyl)phenoxy]ethyl]-1,4-dioxane.
| Compound Name | 2-[2-[4-(trifluoromethylsulfonyl)phenoxy]ethyl]-1,4-dioxane |
|---|---|
| PubChem CID | 166266733 |
| Molecular Formula | C13H15F3O5S |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 2-[2-[4-(trifluoromethylsulfonyl)phenoxy]ethyl]-1,4-dioxane |
| SMILES | O=S(=O)(c1ccc(OCCC2COCCO2)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H15F3O5S/c14-13(15,16)22(17,18)12-3-1-10(2-4-12)20-6-5-11-9-19-7-8-21-11/h1-4,11H,5-9H2 |
| InChIKey | HOFJSEBTWIKWLY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |