C24H25NO4 — CID 175643969
3-[6-[2-(1,4-dioxan-2-yl)ethoxy]naphthalen-2-yl]-N-methylbenzamide (PubChem CID 175643969) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 3-[6-[2-(1,4-dioxan-2-yl)ethoxy]naphthalen-2-yl]-N-methylbenzamide.
| Compound Name | 3-[6-[2-(1,4-dioxan-2-yl)ethoxy]naphthalen-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 175643969 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 3-[6-[2-(1,4-dioxan-2-yl)ethoxy]naphthalen-2-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(-c2ccc3cc(OCCC4COCCO4)ccc3c2)c1 |
| InChI | InChI=1S/C24H25NO4/c1-25-24(26)21-4-2-3-17(14-21)18-5-6-20-15-22(8-7-19(20)13-18)28-10-9-23-16-27-11-12-29-23/h2-8,13-15,23H,9-12,16H2,1H3,(H,25,26) |
| InChIKey | ZVIONVBWDJCNDI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |