C14H17F3N2O5S — CID 68988926
(3R)-3-[2-[4-(trifluoromethylsulfonyl)phenoxy]ethyl]piperazine-1-carboxylic acid (PubChem CID 68988926) has the molecular formula C14H17F3N2O5S and a molecular weight of 382.36 g/mol. Its IUPAC name is (3R)-3-[2-[4-(trifluoromethylsulfonyl)phenoxy]ethyl]piperazine-1-carboxylic acid.
| Compound Name | (3R)-3-[2-[4-(trifluoromethylsulfonyl)phenoxy]ethyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 68988926 |
| Molecular Formula | C14H17F3N2O5S |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | (3R)-3-[2-[4-(trifluoromethylsulfonyl)phenoxy]ethyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN[C@H](CCOc2ccc(S(=O)(=O)C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C14H17F3N2O5S/c15-14(16,17)25(22,23)12-3-1-11(2-4-12)24-8-5-10-9-19(13(20)21)7-6-18-10/h1-4,10,18H,5-9H2,(H,20,21)/t10-/m1/s1 |
| InChIKey | XXSGRYWRGQKEAM-SNVBAGLBSA-N |
| XLogP | 1.70 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |