C12H17N3O4S — CID 68664807
(3R)-3-[(4-sulfamoylphenyl)methyl]piperazine-1-carboxylic acid (PubChem CID 68664807) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is (3R)-3-[(4-sulfamoylphenyl)methyl]piperazine-1-carboxylic acid.
| Compound Name | (3R)-3-[(4-sulfamoylphenyl)methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 68664807 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (3R)-3-[(4-sulfamoylphenyl)methyl]piperazine-1-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc(C[C@@H]2CN(C(=O)O)CCN2)cc1 |
| InChI | InChI=1S/C12H17N3O4S/c13-20(18,19)11-3-1-9(2-4-11)7-10-8-15(12(16)17)6-5-14-10/h1-4,10,14H,5-8H2,(H,16,17)(H2,13,18,19)/t10-/m1/s1 |
| InChIKey | XWTXKWKRRWMYHF-SNVBAGLBSA-N |
| XLogP | -0.17 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |