C24H31NO7S — CID 70166882
2-(4-methoxyphenyl)sulfonyl-2-[[4-(2-morpholin-2-ylethoxy)phenyl]methyl]butanoic acid (PubChem CID 70166882) has the molecular formula C24H31NO7S and a molecular weight of 477.58 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)sulfonyl-2-[[4-(2-morpholin-2-ylethoxy)phenyl]methyl]butanoic acid.
| Compound Name | 2-(4-methoxyphenyl)sulfonyl-2-[[4-(2-morpholin-2-ylethoxy)phenyl]methyl]butanoic acid |
|---|---|
| PubChem CID | 70166882 |
| Molecular Formula | C24H31NO7S |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 2-(4-methoxyphenyl)sulfonyl-2-[[4-(2-morpholin-2-ylethoxy)phenyl]methyl]butanoic acid |
| SMILES | CCC(Cc1ccc(OCCC2CNCCO2)cc1)(C(=O)O)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H31NO7S/c1-3-24(23(26)27,33(28,29)22-10-8-19(30-2)9-11-22)16-18-4-6-20(7-5-18)31-14-12-21-17-25-13-15-32-21/h4-11,21,25H,3,12-17H2,1-2H3,(H,26,27) |
| InChIKey | XRGVQXXAVKEWCP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |