C32H43NO7S — CID 54547173
2-(4-methoxyphenyl)sulfonyl-5,9-dimethyl-2-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]deca-4,8-dienoic acid (PubChem CID 54547173) has the molecular formula C32H43NO7S and a molecular weight of 585.76 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)sulfonyl-5,9-dimethyl-2-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]deca-4,8-dienoic acid.
| Compound Name | 2-(4-methoxyphenyl)sulfonyl-5,9-dimethyl-2-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]deca-4,8-dienoic acid |
|---|---|
| PubChem CID | 54547173 |
| Molecular Formula | C32H43NO7S |
| Molecular Weight | 585.76 g/mol |
| Exact Mass | 585.28 |
| IUPAC Name | 2-(4-methoxyphenyl)sulfonyl-5,9-dimethyl-2-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]deca-4,8-dienoic acid |
| SMILES | COc1ccc(S(=O)(=O)C(CC=C(C)CCC=C(C)C)(Cc2ccc(OCCN3CCOCC3)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C32H43NO7S/c1-25(2)6-5-7-26(3)16-17-32(31(34)35,41(36,37)30-14-12-28(38-4)13-15-30)24-27-8-10-29(11-9-27)40-23-20-33-18-21-39-22-19-33/h6,8-16H,5,7,17-24H2,1-4H3,(H,34,35) |
| InChIKey | ZHIJJVWURAHCNB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.76 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|