C17H14N6O4S — CID 167843166
N-(5-methyl-2-pyridin-2-ylpyrazol-3-yl)-6-nitro-1H-indole-3-sulfonamide (PubChem CID 167843166) has the molecular formula C17H14N6O4S and a molecular weight of 398.40 g/mol. Its IUPAC name is N-(5-methyl-2-pyridin-2-ylpyrazol-3-yl)-6-nitro-1H-indole-3-sulfonamide.
| Compound Name | N-(5-methyl-2-pyridin-2-ylpyrazol-3-yl)-6-nitro-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 167843166 |
| Molecular Formula | C17H14N6O4S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | N-(5-methyl-2-pyridin-2-ylpyrazol-3-yl)-6-nitro-1H-indole-3-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2c[nH]c3cc([N+](=O)[O-])ccc23)n(-c2ccccn2)n1 |
| InChI | InChI=1S/C17H14N6O4S/c1-11-8-17(22(20-11)16-4-2-3-7-18-16)21-28(26,27)15-10-19-14-9-12(23(24)25)5-6-13(14)15/h2-10,19,21H,1H3 |
| InChIKey | LHFNMPRFYASFPW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 135.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|