C25H30N8O2S — CID 24751447
4-N-[3-(diethylamino)propyl]-2-N-(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-6-yl)-4-N-(1H-indazol-4-yl)pyrimidine-2,4-diamine (PubChem CID 24751447) has the molecular formula C25H30N8O2S and a molecular weight of 506.64 g/mol. Its IUPAC name is 4-N-[3-(diethylamino)propyl]-2-N-(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-6-yl)-4-N-(1H-indazol-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(diethylamino)propyl]-2-N-(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-6-yl)-4-N-(1H-indazol-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 24751447 |
| Molecular Formula | C25H30N8O2S |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 4-N-[3-(diethylamino)propyl]-2-N-(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-6-yl)-4-N-(1H-indazol-4-yl)pyrimidine-2,4-diamine |
| SMILES | CCN(CC)CCCN(c1ccnc(Nc2ccc3c(c2)S(=O)(=O)NC3)n1)c1cccc2[nH]ncc12 |
| InChI | InChI=1S/C25H30N8O2S/c1-3-32(4-2)13-6-14-33(22-8-5-7-21-20(22)17-27-31-21)24-11-12-26-25(30-24)29-19-10-9-18-16-28-36(34,35)23(18)15-19/h5,7-12,15,17,28H,3-4,6,13-14,16H2,1-2H3,(H,27,31)(H,26,29,30) |
| InChIKey | NMTYFKLPIIOVFD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |