C20H21FN8O — CID 143515513
3-[[2-(3,4-diaminoanilino)-5-fluoropyrimidin-4-yl]-(1H-indazol-4-yl)amino]propan-1-ol (PubChem CID 143515513) has the molecular formula C20H21FN8O and a molecular weight of 408.44 g/mol. Its IUPAC name is 3-[[2-(3,4-diaminoanilino)-5-fluoropyrimidin-4-yl]-(1H-indazol-4-yl)amino]propan-1-ol.
| Compound Name | 3-[[2-(3,4-diaminoanilino)-5-fluoropyrimidin-4-yl]-(1H-indazol-4-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 143515513 |
| Molecular Formula | C20H21FN8O |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 3-[[2-(3,4-diaminoanilino)-5-fluoropyrimidin-4-yl]-(1H-indazol-4-yl)amino]propan-1-ol |
| SMILES | Nc1ccc(Nc2ncc(F)c(N(CCCO)c3cccc4[nH]ncc34)n2)cc1N |
| InChI | InChI=1S/C20H21FN8O/c21-14-11-24-20(26-12-5-6-15(22)16(23)9-12)27-19(14)29(7-2-8-30)18-4-1-3-17-13(18)10-25-28-17/h1,3-6,9-11,30H,2,7-8,22-23H2,(H,25,28)(H,24,26,27) |
| InChIKey | FYMYGPFHGQGKAO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 142.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|