C14H21N3 — CID 167843392
(3aS,6aR)-2-methyl-N-(pyridin-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 167843392) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is (3aS,6aR)-2-methyl-N-(pyridin-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | (3aS,6aR)-2-methyl-N-(pyridin-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 167843392 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (3aS,6aR)-2-methyl-N-(pyridin-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | CN1C[C@@H]2CCC(NCc3cccnc3)[C@@H]2C1 |
| InChI | InChI=1S/C14H21N3/c1-17-9-12-4-5-14(13(12)10-17)16-8-11-3-2-6-15-7-11/h2-3,6-7,12-14,16H,4-5,8-10H2,1H3/t12-,13+,14?/m0/s1 |
| InChIKey | UBEXWJHICKHHPT-WLDKUNSKSA-N |
| XLogP | 1.51 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |