C14H14Cl2NNaO3 — CID 167843968
sodium 3-[2-(3,5-dichlorophenyl)ethylcarbamoyl]cyclobutane-1-carboxylate (PubChem CID 167843968) has the molecular formula C14H14Cl2NNaO3 and a molecular weight of 338.17 g/mol. Its IUPAC name is sodium 3-[2-(3,5-dichlorophenyl)ethylcarbamoyl]cyclobutane-1-carboxylate.
| Compound Name | sodium 3-[2-(3,5-dichlorophenyl)ethylcarbamoyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 167843968 |
| Molecular Formula | C14H14Cl2NNaO3 |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | sodium 3-[2-(3,5-dichlorophenyl)ethylcarbamoyl]cyclobutane-1-carboxylate |
| SMILES | O=C([O-])C1CC(C(=O)NCCc2cc(Cl)cc(Cl)c2)C1.[Na+] |
| InChI | InChI=1S/C14H15Cl2NO3.Na/c15-11-3-8(4-12(16)7-11)1-2-17-13(18)9-5-10(6-9)14(19)20;/h3-4,7,9-10H,1-2,5-6H2,(H,17,18)(H,19,20);/q;+1/p-1 |
| InChIKey | NQUMXDWLSQEJCF-UHFFFAOYSA-M |
| XLogP | -1.57 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |