C22H24N6O3 — CID 167845013
(10S)-N-methyl-12-[(7-methyl-6-oxo-8aH-1,5-naphthyridin-3-yl)methyl]-8-oxa-1,6,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide (PubChem CID 167845013) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is (10S)-N-methyl-12-[(7-methyl-6-oxo-8aH-1,5-naphthyridin-3-yl)methyl]-8-oxa-1,6,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide.
| Compound Name | (10S)-N-methyl-12-[(7-methyl-6-oxo-8aH-1,5-naphthyridin-3-yl)methyl]-8-oxa-1,6,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide |
|---|---|
| PubChem CID | 167845013 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | (10S)-N-methyl-12-[(7-methyl-6-oxo-8aH-1,5-naphthyridin-3-yl)methyl]-8-oxa-1,6,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide |
| SMILES | CNC(=O)c1ccc2c(n1)OC[C@@H]1CN(CC3=CC4=NC(=O)C(C)=CC4N=C3)CCN21 |
| InChI | InChI=1S/C22H24N6O3/c1-13-7-17-18(25-20(13)29)8-14(9-24-17)10-27-5-6-28-15(11-27)12-31-22-19(28)4-3-16(26-22)21(30)23-2/h3-4,7-9,15,17H,5-6,10-12H2,1-2H3,(H,23,30)/t15-,17?/m0/s1 |
| InChIKey | WPZQDKOEKSUQJR-MYJWUSKBSA-N |
| XLogP | 0.63 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |