C18H20F3N3O3 — CID 167845669
methyl 2-(3-methylpent-4-enoylamino)-3-[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]propanoate (PubChem CID 167845669) has the molecular formula C18H20F3N3O3 and a molecular weight of 383.37 g/mol. Its IUPAC name is methyl 2-(3-methylpent-4-enoylamino)-3-[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]propanoate.
| Compound Name | methyl 2-(3-methylpent-4-enoylamino)-3-[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 167845669 |
| Molecular Formula | C18H20F3N3O3 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | methyl 2-(3-methylpent-4-enoylamino)-3-[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]propanoate |
| SMILES | C=CC(C)CC(=O)NC(Cc1ccc(C2(C(F)(F)F)N=N2)cc1)C(=O)OC |
| InChI | InChI=1S/C18H20F3N3O3/c1-4-11(2)9-15(25)22-14(16(26)27-3)10-12-5-7-13(8-6-12)17(23-24-17)18(19,20)21/h4-8,11,14H,1,9-10H2,2-3H3,(H,22,25) |
| InChIKey | TYPBVGSQUMQOJQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|