C22H32F3NO5 — CID 142216274
ethane;methyl 3-(4-formyloxyphenyl)-2-[[(2Z)-penta-2,4-dien-2-yl]amino]propanoate;2,2,2-trifluoroacetaldehyde (PubChem CID 142216274) has the molecular formula C22H32F3NO5 and a molecular weight of 447.49 g/mol. Its IUPAC name is ethane;methyl 3-(4-formyloxyphenyl)-2-[[(2Z)-penta-2,4-dien-2-yl]amino]propanoate;2,2,2-trifluoroacetaldehyde.
| Compound Name | ethane;methyl 3-(4-formyloxyphenyl)-2-[[(2Z)-penta-2,4-dien-2-yl]amino]propanoate;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 142216274 |
| Molecular Formula | C22H32F3NO5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | ethane;methyl 3-(4-formyloxyphenyl)-2-[[(2Z)-penta-2,4-dien-2-yl]amino]propanoate;2,2,2-trifluoroacetaldehyde |
| SMILES | C=C/C=C(/C)NC(Cc1ccc(OC=O)cc1)C(=O)OC.CC.CC.O=CC(F)(F)F |
| InChI | InChI=1S/C16H19NO4.C2HF3O.2C2H6/c1-4-5-12(2)17-15(16(19)20-3)10-13-6-8-14(9-7-13)21-11-18;3-2(4,5)1-6;2*1-2/h4-9,11,15,17H,1,10H2,2-3H3;1H;2*1-2H3/b12-5-;;; |
| InChIKey | UOLVCUWRBFRCFZ-WYRZPCFZSA-N |
| XLogP | 4.79 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|