C13H20N6O4 — CID 167848306
N-[2-(methoxyamino)-2-oxoethyl]-4-(6-methoxypyrimidin-4-yl)piperazine-1-carboxamide (PubChem CID 167848306) has the molecular formula C13H20N6O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is N-[2-(methoxyamino)-2-oxoethyl]-4-(6-methoxypyrimidin-4-yl)piperazine-1-carboxamide.
| Compound Name | N-[2-(methoxyamino)-2-oxoethyl]-4-(6-methoxypyrimidin-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 167848306 |
| Molecular Formula | C13H20N6O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-[2-(methoxyamino)-2-oxoethyl]-4-(6-methoxypyrimidin-4-yl)piperazine-1-carboxamide |
| SMILES | CONC(=O)CNC(=O)N1CCN(c2cc(OC)ncn2)CC1 |
| InChI | InChI=1S/C13H20N6O4/c1-22-12-7-10(15-9-16-12)18-3-5-19(6-4-18)13(21)14-8-11(20)17-23-2/h7,9H,3-6,8H2,1-2H3,(H,14,21)(H,17,20) |
| InChIKey | OGSMIRXTAOPDIR-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|