C13H13FN2O3 — CID 167850019
7-fluoro-4-(oxolane-2-carbonyl)-1,3-dihydroquinoxalin-2-one (PubChem CID 167850019) has the molecular formula C13H13FN2O3 and a molecular weight of 264.26 g/mol. Its IUPAC name is 7-fluoro-4-(oxolane-2-carbonyl)-1,3-dihydroquinoxalin-2-one.
| Compound Name | 7-fluoro-4-(oxolane-2-carbonyl)-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 167850019 |
| Molecular Formula | C13H13FN2O3 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 7-fluoro-4-(oxolane-2-carbonyl)-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(C(=O)C2CCCO2)c2ccc(F)cc2N1 |
| InChI | InChI=1S/C13H13FN2O3/c14-8-3-4-10-9(6-8)15-12(17)7-16(10)13(18)11-2-1-5-19-11/h3-4,6,11H,1-2,5,7H2,(H,15,17) |
| InChIKey | WIZUBCBWTQUPJZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |