C15H18N2O3 — CID 65365324
4-(oxane-2-carbonyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one (PubChem CID 65365324) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-(oxane-2-carbonyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one.
| Compound Name | 4-(oxane-2-carbonyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 65365324 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 4-(oxane-2-carbonyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
| SMILES | O=C1CN(C(=O)C2CCCCO2)Cc2ccccc2N1 |
| InChI | InChI=1S/C15H18N2O3/c18-14-10-17(15(19)13-7-3-4-8-20-13)9-11-5-1-2-6-12(11)16-14/h1-2,5-6,13H,3-4,7-10H2,(H,16,18) |
| InChIKey | XPLJOMJWUZTGCA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |