C7H8N2O3 — CID 16785259
2-(oxiran-2-ylmethyl)-1H-pyridazine-3,6-dione (PubChem CID 16785259) has the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethyl)-1H-pyridazine-3,6-dione.
| Compound Name | 2-(oxiran-2-ylmethyl)-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 16785259 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 2-(oxiran-2-ylmethyl)-1H-pyridazine-3,6-dione |
| SMILES | O=c1ccc(=O)n(CC2CO2)[nH]1 |
| InChI | InChI=1S/C7H8N2O3/c10-6-1-2-7(11)9(8-6)3-5-4-12-5/h1-2,5H,3-4H2,(H,8,10) |
| InChIKey | JDKWYKCHXGULIN-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|