C11H16N2O2S2 — CID 167854338
2-cyclobutyl-5-(cyclobutylsulfonylmethyl)-1,3,4-thiadiazole (PubChem CID 167854338) has the molecular formula C11H16N2O2S2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-cyclobutyl-5-(cyclobutylsulfonylmethyl)-1,3,4-thiadiazole.
| Compound Name | 2-cyclobutyl-5-(cyclobutylsulfonylmethyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 167854338 |
| Molecular Formula | C11H16N2O2S2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-cyclobutyl-5-(cyclobutylsulfonylmethyl)-1,3,4-thiadiazole |
| SMILES | O=S(=O)(Cc1nnc(C2CCC2)s1)C1CCC1 |
| InChI | InChI=1S/C11H16N2O2S2/c14-17(15,9-5-2-6-9)7-10-12-13-11(16-10)8-3-1-4-8/h8-9H,1-7H2 |
| InChIKey | IWQSPAIWXQLVRR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |