C8H12N2O3S2 — CID 172800971
2-(5-cyclobutyl-1,3,4-thiadiazol-2-yl)ethanesulfonic acid (PubChem CID 172800971) has the molecular formula C8H12N2O3S2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-(5-cyclobutyl-1,3,4-thiadiazol-2-yl)ethanesulfonic acid.
| Compound Name | 2-(5-cyclobutyl-1,3,4-thiadiazol-2-yl)ethanesulfonic acid |
|---|---|
| PubChem CID | 172800971 |
| Molecular Formula | C8H12N2O3S2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 2-(5-cyclobutyl-1,3,4-thiadiazol-2-yl)ethanesulfonic acid |
| SMILES | O=S(=O)(O)CCc1nnc(C2CCC2)s1 |
| InChI | InChI=1S/C8H12N2O3S2/c11-15(12,13)5-4-7-9-10-8(14-7)6-2-1-3-6/h6H,1-5H2,(H,11,12,13) |
| InChIKey | QVXKASPOWZSODW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|